C19H16N4O3 — CID 51112697
[4-(2-oxopyrrolidin-1-yl)phenyl] 6-pyrazol-1-ylpyridine-3-carboxylate (PubChem CID 51112697) has the molecular formula C19H16N4O3 and a molecular weight of 348.36 g/mol. Its IUPAC name is [4-(2-oxopyrrolidin-1-yl)phenyl] 6-pyrazol-1-ylpyridine-3-carboxylate.
| Compound Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 6-pyrazol-1-ylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 51112697 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 6-pyrazol-1-ylpyridine-3-carboxylate |
| SMILES | O=C(Oc1ccc(N2CCCC2=O)cc1)c1ccc(-n2cccn2)nc1 |
| InChI | InChI=1S/C19H16N4O3/c24-18-3-1-11-22(18)15-5-7-16(8-6-15)26-19(25)14-4-9-17(20-13-14)23-12-2-10-21-23/h2,4-10,12-13H,1,3,11H2 |
| InChIKey | YIQWZEIHAMJMTA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|