C20H17NO4 — CID 35545788
[4-(2-oxopyrrolidin-1-yl)phenyl] 2H-chromene-3-carboxylate (PubChem CID 35545788) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is [4-(2-oxopyrrolidin-1-yl)phenyl] 2H-chromene-3-carboxylate.
| Compound Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 35545788 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 2H-chromene-3-carboxylate |
| SMILES | O=C(Oc1ccc(N2CCCC2=O)cc1)C1=Cc2ccccc2OC1 |
| InChI | InChI=1S/C20H17NO4/c22-19-6-3-11-21(19)16-7-9-17(10-8-16)25-20(23)15-12-14-4-1-2-5-18(14)24-13-15/h1-2,4-5,7-10,12H,3,6,11,13H2 |
| InChIKey | ILUCFKSDTQRZDI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|