C22H20N2O4 — CID 55355394
[2-(3,5-dimethylanilino)-2-oxoethyl] 2-phenoxypyridine-3-carboxylate (PubChem CID 55355394) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is [2-(3,5-dimethylanilino)-2-oxoethyl] 2-phenoxypyridine-3-carboxylate.
| Compound Name | [2-(3,5-dimethylanilino)-2-oxoethyl] 2-phenoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 55355394 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | [2-(3,5-dimethylanilino)-2-oxoethyl] 2-phenoxypyridine-3-carboxylate |
| SMILES | Cc1cc(C)cc(NC(=O)COC(=O)c2cccnc2Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H20N2O4/c1-15-11-16(2)13-17(12-15)24-20(25)14-27-22(26)19-9-6-10-23-21(19)28-18-7-4-3-5-8-18/h3-13H,14H2,1-2H3,(H,24,25) |
| InChIKey | AHCRVZKRDAQKRC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |