C23H19ClN2O4S — CID 36698957
[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate (PubChem CID 36698957) has the molecular formula C23H19ClN2O4S and a molecular weight of 454.94 g/mol. Its IUPAC name is [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 36698957 |
| Molecular Formula | C23H19ClN2O4S |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] (E)-3-(3-chloro-1-benzothiophen-2-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1sc2ccccc2c1Cl)Nc1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C23H19ClN2O4S/c24-23-17-7-1-2-8-18(17)31-19(23)10-11-22(29)30-14-20(27)25-15-5-3-6-16(13-15)26-12-4-9-21(26)28/h1-3,5-8,10-11,13H,4,9,12,14H2,(H,25,27)/b11-10+ |
| InChIKey | KEDDFRNWMRSCCB-ZHACJKMWSA-N |
| XLogP | 4.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|