C17H12ClF2NO3 — CID 7970750
[2-(2-chloro-4-fluoroanilino)-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate (PubChem CID 7970750) has the molecular formula C17H12ClF2NO3 and a molecular weight of 351.74 g/mol. Its IUPAC name is [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7970750 |
| Molecular Formula | C17H12ClF2NO3 |
| Molecular Weight | 351.74 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccccc1F)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H12ClF2NO3/c18-13-9-12(19)6-7-15(13)21-16(22)10-24-17(23)8-5-11-3-1-2-4-14(11)20/h1-9H,10H2,(H,21,22)/b8-5+ |
| InChIKey | ZNTDERTZJMNJRJ-VMPITWQZSA-N |
| XLogP | 3.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.74 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|