C18H12F2N2O9 — CID 2467635
3-O-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate (PubChem CID 2467635) has the molecular formula C18H12F2N2O9 and a molecular weight of 438.30 g/mol. Its IUPAC name is 3-O-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 3-O-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 2467635 |
| Molecular Formula | C18H12F2N2O9 |
| Molecular Weight | 438.30 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | 3-O-[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OCC(=O)Nc2ccc3c(c2)OC(F)(F)O3)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H12F2N2O9/c1-28-16(24)9-4-10(6-12(5-9)22(26)27)17(25)29-8-15(23)21-11-2-3-13-14(7-11)31-18(19,20)30-13/h2-7H,8H2,1H3,(H,21,23) |
| InChIKey | HQXKNDWXOVMAFX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|