C16H12F2N2O7 — CID 7931756
N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-(2-methoxy-5-nitrophenoxy)acetamide (PubChem CID 7931756) has the molecular formula C16H12F2N2O7 and a molecular weight of 382.28 g/mol. Its IUPAC name is N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-(2-methoxy-5-nitrophenoxy)acetamide.
| Compound Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-(2-methoxy-5-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 7931756 |
| Molecular Formula | C16H12F2N2O7 |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-(2-methoxy-5-nitrophenoxy)acetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1OCC(=O)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C16H12F2N2O7/c1-24-11-5-3-10(20(22)23)7-13(11)25-8-15(21)19-9-2-4-12-14(6-9)27-16(17,18)26-12/h2-7H,8H2,1H3,(H,19,21) |
| InChIKey | XUELTAQVVDKBSF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|