C19H13F2NO4 — CID 7860183
N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-naphthalen-1-yloxyacetamide (PubChem CID 7860183) has the molecular formula C19H13F2NO4 and a molecular weight of 357.31 g/mol. Its IUPAC name is N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-naphthalen-1-yloxyacetamide.
| Compound Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-naphthalen-1-yloxyacetamide |
|---|---|
| PubChem CID | 7860183 |
| Molecular Formula | C19H13F2NO4 |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-naphthalen-1-yloxyacetamide |
| SMILES | O=C(COc1cccc2ccccc12)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C19H13F2NO4/c20-19(21)25-16-9-8-13(10-17(16)26-19)22-18(23)11-24-15-7-3-5-12-4-1-2-6-14(12)15/h1-10H,11H2,(H,22,23) |
| InChIKey | NISNSLKVNLVNPI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |