C19H17F2NO5 — CID 42899592
N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-[(5-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]acetamide (PubChem CID 42899592) has the molecular formula C19H17F2NO5 and a molecular weight of 377.34 g/mol. Its IUPAC name is N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-[(5-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]acetamide.
| Compound Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-[(5-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]acetamide |
|---|---|
| PubChem CID | 42899592 |
| Molecular Formula | C19H17F2NO5 |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-[(5-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]acetamide |
| SMILES | O=C(COc1cccc2c1CCCC2O)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C19H17F2NO5/c20-19(21)26-16-8-7-11(9-17(16)27-19)22-18(24)10-25-15-6-2-3-12-13(15)4-1-5-14(12)23/h2-3,6-9,14,23H,1,4-5,10H2,(H,22,24) |
| InChIKey | DSKDYDQWWDVGET-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |