C19H20O5S — CID 55463350
[2-(5-methylthiophen-2-yl)-2-oxoethyl] 3,4-dimethoxy-5-prop-2-enylbenzoate (PubChem CID 55463350) has the molecular formula C19H20O5S and a molecular weight of 360.43 g/mol. Its IUPAC name is [2-(5-methylthiophen-2-yl)-2-oxoethyl] 3,4-dimethoxy-5-prop-2-enylbenzoate.
| Compound Name | [2-(5-methylthiophen-2-yl)-2-oxoethyl] 3,4-dimethoxy-5-prop-2-enylbenzoate |
|---|---|
| PubChem CID | 55463350 |
| Molecular Formula | C19H20O5S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | [2-(5-methylthiophen-2-yl)-2-oxoethyl] 3,4-dimethoxy-5-prop-2-enylbenzoate |
| SMILES | C=CCc1cc(C(=O)OCC(=O)c2ccc(C)s2)cc(OC)c1OC |
| InChI | InChI=1S/C19H20O5S/c1-5-6-13-9-14(10-16(22-3)18(13)23-4)19(21)24-11-15(20)17-8-7-12(2)25-17/h5,7-10H,1,6,11H2,2-4H3 |
| InChIKey | USKRRPKVMFLDGK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|