C21H23NO6S — CID 2511507
[2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 3-phenoxybenzoate (PubChem CID 2511507) has the molecular formula C21H23NO6S and a molecular weight of 417.48 g/mol. Its IUPAC name is [2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 3-phenoxybenzoate.
| Compound Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 3-phenoxybenzoate |
|---|---|
| PubChem CID | 2511507 |
| Molecular Formula | C21H23NO6S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 3-phenoxybenzoate |
| SMILES | CCN(C(=O)COC(=O)c1cccc(Oc2ccccc2)c1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H23NO6S/c1-2-22(17-11-12-29(25,26)15-17)20(23)14-27-21(24)16-7-6-10-19(13-16)28-18-8-4-3-5-9-18/h3-10,13,17H,2,11-12,14-15H2,1H3/t17-/m1/s1 |
| InChIKey | FWZNDYGAJPMWJG-QGZVFWFLSA-N |
| XLogP | 2.67 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |