C23H20Cl2N2O7S — CID 3943396
[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(3,4-dichlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 3943396) has the molecular formula C23H20Cl2N2O7S and a molecular weight of 539.39 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(3,4-dichlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(3,4-dichlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 3943396 |
| Molecular Formula | C23H20Cl2N2O7S |
| Molecular Weight | 539.39 g/mol |
| Exact Mass | 538.04 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(3,4-dichlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCN(C(=O)COC(=O)c1ccc2c(c1)C(=O)N(c1ccc(Cl)c(Cl)c1)C2=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H20Cl2N2O7S/c1-2-26(15-7-8-35(32,33)12-15)20(28)11-34-23(31)13-3-5-16-17(9-13)22(30)27(21(16)29)14-4-6-18(24)19(25)10-14/h3-6,9-10,15H,2,7-8,11-12H2,1H3 |
| InChIKey | HYNUXPXLDKGHEO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|