C21H32N2O7S — CID 55324178
[2-[butyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate (PubChem CID 55324178) has the molecular formula C21H32N2O7S and a molecular weight of 456.56 g/mol. Its IUPAC name is [2-[butyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate.
| Compound Name | [2-[butyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 55324178 |
| Molecular Formula | C21H32N2O7S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | [2-[butyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate |
| SMILES | CCCCN(C(=O)COC(=O)C(C)N1C(=O)C2CCCCC2C1=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H32N2O7S/c1-3-4-10-22(15-9-11-31(28,29)13-15)18(24)12-30-21(27)14(2)23-19(25)16-7-5-6-8-17(16)20(23)26/h14-17H,3-13H2,1-2H3 |
| InChIKey | NXVRUONEEYKYOG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|