C22H19NO4S — CID 7859755
[2-(2-methylsulfanylanilino)-2-oxoethyl] 4-phenoxybenzoate (PubChem CID 7859755) has the molecular formula C22H19NO4S and a molecular weight of 393.46 g/mol. Its IUPAC name is [2-(2-methylsulfanylanilino)-2-oxoethyl] 4-phenoxybenzoate.
| Compound Name | [2-(2-methylsulfanylanilino)-2-oxoethyl] 4-phenoxybenzoate |
|---|---|
| PubChem CID | 7859755 |
| Molecular Formula | C22H19NO4S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | [2-(2-methylsulfanylanilino)-2-oxoethyl] 4-phenoxybenzoate |
| SMILES | CSc1ccccc1NC(=O)COC(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C22H19NO4S/c1-28-20-10-6-5-9-19(20)23-21(24)15-26-22(25)16-11-13-18(14-12-16)27-17-7-3-2-4-8-17/h2-14H,15H2,1H3,(H,23,24) |
| InChIKey | WJJWSFHNEGDDRV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |