C16H19N3O5S — CID 18083220
[2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] 2-methylsulfonylbenzoate (PubChem CID 18083220) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is [2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] 2-methylsulfonylbenzoate.
| Compound Name | [2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] 2-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 18083220 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | [2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] 2-methylsulfonylbenzoate |
| SMILES | CC(C)n1nccc1NC(=O)COC(=O)c1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C16H19N3O5S/c1-11(2)19-14(8-9-17-19)18-15(20)10-24-16(21)12-6-4-5-7-13(12)25(3,22)23/h4-9,11H,10H2,1-3H3,(H,18,20) |
| InChIKey | DOKJFZVLKFZVTI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |