C17H13ClN2O5S — CID 7724580
[2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-methylsulfonylbenzoate (PubChem CID 7724580) has the molecular formula C17H13ClN2O5S and a molecular weight of 392.82 g/mol. Its IUPAC name is [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-methylsulfonylbenzoate.
| Compound Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 7724580 |
| Molecular Formula | C17H13ClN2O5S |
| Molecular Weight | 392.82 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1ccccc1C(=O)OCC(=O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C17H13ClN2O5S/c1-26(23,24)15-5-3-2-4-13(15)17(22)25-10-16(21)20-12-7-6-11(9-19)14(18)8-12/h2-8H,10H2,1H3,(H,20,21) |
| InChIKey | CGDHJIWAULEPND-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.82 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |