C18H17F2NO3S — CID 8959454
[(2S)-1-(3,4-difluoroanilino)-1-oxopropan-2-yl] 2-ethylsulfanylbenzoate (PubChem CID 8959454) has the molecular formula C18H17F2NO3S and a molecular weight of 365.40 g/mol. Its IUPAC name is [(2S)-1-(3,4-difluoroanilino)-1-oxopropan-2-yl] 2-ethylsulfanylbenzoate.
| Compound Name | [(2S)-1-(3,4-difluoroanilino)-1-oxopropan-2-yl] 2-ethylsulfanylbenzoate |
|---|---|
| PubChem CID | 8959454 |
| Molecular Formula | C18H17F2NO3S |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | [(2S)-1-(3,4-difluoroanilino)-1-oxopropan-2-yl] 2-ethylsulfanylbenzoate |
| SMILES | CCSc1ccccc1C(=O)O[C@@H](C)C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H17F2NO3S/c1-3-25-16-7-5-4-6-13(16)18(23)24-11(2)17(22)21-12-8-9-14(19)15(20)10-12/h4-11H,3H2,1-2H3,(H,21,22)/t11-/m0/s1 |
| InChIKey | XLOQXOMUTQKUJC-NSHDSACASA-N |
| XLogP | 4.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |