C25H23F2NO5 — CID 46817744
[4-(difluoromethoxy)-3-methoxyphenyl]methyl 2-benzamido-3-phenylpropanoate (PubChem CID 46817744) has the molecular formula C25H23F2NO5 and a molecular weight of 455.46 g/mol. Its IUPAC name is [4-(difluoromethoxy)-3-methoxyphenyl]methyl 2-benzamido-3-phenylpropanoate.
| Compound Name | [4-(difluoromethoxy)-3-methoxyphenyl]methyl 2-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 46817744 |
| Molecular Formula | C25H23F2NO5 |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | [4-(difluoromethoxy)-3-methoxyphenyl]methyl 2-benzamido-3-phenylpropanoate |
| SMILES | COc1cc(COC(=O)C(Cc2ccccc2)NC(=O)c2ccccc2)ccc1OC(F)F |
| InChI | InChI=1S/C25H23F2NO5/c1-31-22-15-18(12-13-21(22)33-25(26)27)16-32-24(30)20(14-17-8-4-2-5-9-17)28-23(29)19-10-6-3-7-11-19/h2-13,15,20,25H,14,16H2,1H3,(H,28,29) |
| InChIKey | QBDUNXBJILBKEW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |