C19H21NO6 — CID 10861285
2-hydroxyethyl (2S)-2-benzamido-3-(4-hydroxy-3-methoxyphenyl)propanoate (PubChem CID 10861285) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is 2-hydroxyethyl (2S)-2-benzamido-3-(4-hydroxy-3-methoxyphenyl)propanoate.
| Compound Name | 2-hydroxyethyl (2S)-2-benzamido-3-(4-hydroxy-3-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 10861285 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-hydroxyethyl (2S)-2-benzamido-3-(4-hydroxy-3-methoxyphenyl)propanoate |
| SMILES | COc1cc(C[C@H](NC(=O)c2ccccc2)C(=O)OCCO)ccc1O |
| InChI | InChI=1S/C19H21NO6/c1-25-17-12-13(7-8-16(17)22)11-15(19(24)26-10-9-21)20-18(23)14-5-3-2-4-6-14/h2-8,12,15,21-22H,9-11H2,1H3,(H,20,23)/t15-/m0/s1 |
| InChIKey | HXDFBRRZHKEHEK-HNNXBMFYSA-N |
| XLogP | 1.28 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |