C25H40O5Si2 — CID 11352018
1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5,8-dimethoxynaphthalene-2-carbaldehyde (PubChem CID 11352018) has the molecular formula C25H40O5Si2 and a molecular weight of 476.76 g/mol. Its IUPAC name is 1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5,8-dimethoxynaphthalene-2-carbaldehyde.
| Compound Name | 1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5,8-dimethoxynaphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 11352018 |
| Molecular Formula | C25H40O5Si2 |
| Molecular Weight | 476.76 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5,8-dimethoxynaphthalene-2-carbaldehyde |
| SMILES | COc1ccc(OC)c2c(O[Si](C)(C)C(C)(C)C)c(C=O)cc(O[Si](C)(C)C(C)(C)C)c12 |
| InChI | InChI=1S/C25H40O5Si2/c1-24(2,3)31(9,10)29-20-15-17(16-26)23(30-32(11,12)25(4,5)6)22-19(28-8)14-13-18(27-7)21(20)22/h13-16H,1-12H3 |
| InChIKey | YWCRLBCZTSCMGR-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.76 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|