C22H29NO4Si — CID 174029046
6-[[(1S)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-1-yl]oxy]-2-methoxypyridine-3-carbaldehyde (PubChem CID 174029046) has the molecular formula C22H29NO4Si and a molecular weight of 399.56 g/mol. Its IUPAC name is 6-[[(1S)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-1-yl]oxy]-2-methoxypyridine-3-carbaldehyde.
| Compound Name | 6-[[(1S)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-1-yl]oxy]-2-methoxypyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 174029046 |
| Molecular Formula | C22H29NO4Si |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 6-[[(1S)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-1-yl]oxy]-2-methoxypyridine-3-carbaldehyde |
| SMILES | COc1nc(O[C@H]2CCc3c(O[Si](C)(C)C(C)(C)C)cccc32)ccc1C=O |
| InChI | InChI=1S/C22H29NO4Si/c1-22(2,3)28(5,6)27-19-9-7-8-16-17(19)11-12-18(16)26-20-13-10-15(14-24)21(23-20)25-4/h7-10,13-14,18H,11-12H2,1-6H3/t18-/m0/s1 |
| InChIKey | FNROSFGRHYGWNL-SFHVURJKSA-N |
| XLogP | 5.35 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|