C9H9IO2 — CID 130741729
(4S)-7-iodo-3,4-dihydro-2H-chromen-4-ol (PubChem CID 130741729) has the molecular formula C9H9IO2 and a molecular weight of 276.07 g/mol. Its IUPAC name is (4S)-7-iodo-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4S)-7-iodo-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 130741729 |
| Molecular Formula | C9H9IO2 |
| Molecular Weight | 276.07 g/mol |
| Exact Mass | 275.96 |
| IUPAC Name | (4S)-7-iodo-3,4-dihydro-2H-chromen-4-ol |
| SMILES | O[C@H]1CCOc2cc(I)ccc21 |
| InChI | InChI=1S/C9H9IO2/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-2,5,8,11H,3-4H2/t8-/m0/s1 |
| InChIKey | VTSUGIWVDPNQJM-QMMMGPOBSA-N |
| XLogP | 2.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.07 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|