About 6-iodo-4-methyl-3,4-dihydro-2H-chromene
6-iodo-4-methyl-3,4-dihydro-2H-chromene (PubChem CID 10612333) has the molecular formula C10H11IO
and a molecular weight of 274.10 g/mol. Its IUPAC name is 6-iodo-4-methyl-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 6-iodo-4-methyl-3,4-dihydro-2H-chromene |
| PubChem CID | 10612333 |
| Molecular Formula | C10H11IO |
| Molecular Weight | 274.10 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 6-iodo-4-methyl-3,4-dihydro-2H-chromene |
| SMILES | CC1CCOc2ccc(I)cc21 |
| InChI | InChI=1S/C10H11IO/c1-7-4-5-12-10-3-2-8(11)6-9(7)10/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | SYAZTYPBLVGBLI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.10 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-4-methyl-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-4-methyl-3,4-dihydro-2H-chromene?
The IUPAC name of 6-iodo-4-methyl-3,4-dihydro-2H-chromene (CID 10612333) is 6-iodo-4-methyl-3,4-dihydro-2H-chromene.
What is the SMILES notation for 6-iodo-4-methyl-3,4-dihydro-2H-chromene?
The canonical SMILES for 6-iodo-4-methyl-3,4-dihydro-2H-chromene is CC1CCOc2ccc(I)cc21.
What is the InChIKey of 6-iodo-4-methyl-3,4-dihydro-2H-chromene?
The InChIKey is SYAZTYPBLVGBLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11IO/c1-7-4-5-12-10-3-2-8(11)6-9(7)10/h2-3,6-7H,4-5H2,1H3.
What are the key properties of 6-iodo-4-methyl-3,4-dihydro-2H-chromene?
6-iodo-4-methyl-3,4-dihydro-2H-chromene has a molecular weight of 274.10 g/mol, XLogP of 3.18, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-4-methyl-3,4-dihydro-2H-chromene is sourced from PubChem (CID 10612333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).