C10H12INO2 — CID 130039876
6-iodo-3-methoxy-3,4-dihydro-2H-chromen-4-amine (PubChem CID 130039876) has the molecular formula C10H12INO2 and a molecular weight of 305.12 g/mol. Its IUPAC name is 6-iodo-3-methoxy-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 6-iodo-3-methoxy-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 130039876 |
| Molecular Formula | C10H12INO2 |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | 6-iodo-3-methoxy-3,4-dihydro-2H-chromen-4-amine |
| SMILES | COC1COc2ccc(I)cc2C1N |
| InChI | InChI=1S/C10H12INO2/c1-13-9-5-14-8-3-2-6(11)4-7(8)10(9)12/h2-4,9-10H,5,12H2,1H3 |
| InChIKey | ZQINQXSYDPOJTA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|