C10H14N2O2 — CID 130039862
3-methoxy-3,4-dihydro-2H-chromene-4,7-diamine (PubChem CID 130039862) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-methoxy-3,4-dihydro-2H-chromene-4,7-diamine.
| Compound Name | 3-methoxy-3,4-dihydro-2H-chromene-4,7-diamine |
|---|---|
| PubChem CID | 130039862 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 3-methoxy-3,4-dihydro-2H-chromene-4,7-diamine |
| SMILES | COC1COc2cc(N)ccc2C1N |
| InChI | InChI=1S/C10H14N2O2/c1-13-9-5-14-8-4-6(11)2-3-7(8)10(9)12/h2-4,9-10H,5,11-12H2,1H3 |
| InChIKey | SIKQVWHBUBNZHU-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|