C14H21NO4 — CID 104560707
3-[2-(2-methoxyethoxy)ethoxy]-3,4-dihydro-2H-chromen-4-amine (PubChem CID 104560707) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 3-[2-(2-methoxyethoxy)ethoxy]-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 3-[2-(2-methoxyethoxy)ethoxy]-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 104560707 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 3-[2-(2-methoxyethoxy)ethoxy]-3,4-dihydro-2H-chromen-4-amine |
| SMILES | COCCOCCOC1COc2ccccc2C1N |
| InChI | InChI=1S/C14H21NO4/c1-16-6-7-17-8-9-18-13-10-19-12-5-3-2-4-11(12)14(13)15/h2-5,13-14H,6-10,15H2,1H3 |
| InChIKey | QIYWYVNKBAAFIR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|