C15H21NO3 — CID 62382431
3-(oxan-4-ylmethoxy)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 62382431) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 3-(oxan-4-ylmethoxy)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 3-(oxan-4-ylmethoxy)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 62382431 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 3-(oxan-4-ylmethoxy)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | NC1c2ccccc2OCC1OCC1CCOCC1 |
| InChI | InChI=1S/C15H21NO3/c16-15-12-3-1-2-4-13(12)19-10-14(15)18-9-11-5-7-17-8-6-11/h1-4,11,14-15H,5-10,16H2 |
| InChIKey | JJHARAMQMXPQLW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |