C10H13NO2 — CID 69173568
(4R)-7-(methylamino)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 69173568) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (4R)-7-(methylamino)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4R)-7-(methylamino)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 69173568 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (4R)-7-(methylamino)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | CNc1ccc2c(c1)OCC[C@H]2O |
| InChI | InChI=1S/C10H13NO2/c1-11-7-2-3-8-9(12)4-5-13-10(8)6-7/h2-3,6,9,11-12H,4-5H2,1H3/t9-/m1/s1 |
| InChIKey | ZJNVYFQRZAADEC-SECBINFHSA-N |
| XLogP | 1.54 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |