C18H26O3Si — CID 141146350
tert-butyl-dimethyl-(1,2,4,5-tetrahydropyrano[3,4-c]chromen-8-yloxy)silane (PubChem CID 141146350) has the molecular formula C18H26O3Si and a molecular weight of 318.49 g/mol. Its IUPAC name is tert-butyl-dimethyl-(1,2,4,5-tetrahydropyrano[3,4-c]chromen-8-yloxy)silane.
| Compound Name | tert-butyl-dimethyl-(1,2,4,5-tetrahydropyrano[3,4-c]chromen-8-yloxy)silane |
|---|---|
| PubChem CID | 141146350 |
| Molecular Formula | C18H26O3Si |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | tert-butyl-dimethyl-(1,2,4,5-tetrahydropyrano[3,4-c]chromen-8-yloxy)silane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)OCC1=C2CCOC1 |
| InChI | InChI=1S/C18H26O3Si/c1-18(2,3)22(4,5)21-14-6-7-16-15-8-9-19-11-13(15)12-20-17(16)10-14/h6-7,10H,8-9,11-12H2,1-5H3 |
| InChIKey | BFYGQHKFLJNOJJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|