C15H20O3 — CID 59564135
7-cyclopentyloxy-6-methyl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 59564135) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 7-cyclopentyloxy-6-methyl-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 7-cyclopentyloxy-6-methyl-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 59564135 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 7-cyclopentyloxy-6-methyl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | Cc1cc2c(cc1OC1CCCC1)OCCC2O |
| InChI | InChI=1S/C15H20O3/c1-10-8-12-13(16)6-7-17-15(12)9-14(10)18-11-4-2-3-5-11/h8-9,11,13,16H,2-7H2,1H3 |
| InChIKey | YUXDINHGSPOZNM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |