C16H24O — CID 126707098
1-cyclohexyloxy-5-ethyl-2,4-dimethylbenzene (PubChem CID 126707098) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is 1-cyclohexyloxy-5-ethyl-2,4-dimethylbenzene.
| Compound Name | 1-cyclohexyloxy-5-ethyl-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 126707098 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 1-cyclohexyloxy-5-ethyl-2,4-dimethylbenzene |
| SMILES | CCc1cc(OC2CCCCC2)c(C)cc1C |
| InChI | InChI=1S/C16H24O/c1-4-14-11-16(13(3)10-12(14)2)17-15-8-6-5-7-9-15/h10-11,15H,4-9H2,1-3H3 |
| InChIKey | SVCCSGBEUGXMAX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |