C13H18FNO — CID 104772612
4-(3,4-dihydro-2H-chromen-4-yl)-3-fluorobutan-1-amine (PubChem CID 104772612) has the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-chromen-4-yl)-3-fluorobutan-1-amine.
| Compound Name | 4-(3,4-dihydro-2H-chromen-4-yl)-3-fluorobutan-1-amine |
|---|---|
| PubChem CID | 104772612 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 4-(3,4-dihydro-2H-chromen-4-yl)-3-fluorobutan-1-amine |
| SMILES | NCCC(F)CC1CCOc2ccccc21 |
| InChI | InChI=1S/C13H18FNO/c14-11(5-7-15)9-10-6-8-16-13-4-2-1-3-12(10)13/h1-4,10-11H,5-9,15H2 |
| InChIKey | GSYXALZOFRBVCJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |