C14H11NO — CID 167433276
2,3-dihydro-1H-benzo[f]chromene-8-carbonitrile (PubChem CID 167433276) has the molecular formula C14H11NO and a molecular weight of 209.25 g/mol. Its IUPAC name is 2,3-dihydro-1H-benzo[f]chromene-8-carbonitrile.
| Compound Name | 2,3-dihydro-1H-benzo[f]chromene-8-carbonitrile |
|---|---|
| PubChem CID | 167433276 |
| Molecular Formula | C14H11NO |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 2,3-dihydro-1H-benzo[f]chromene-8-carbonitrile |
| SMILES | N#Cc1ccc2c3c(ccc2c1)OCCC3 |
| InChI | InChI=1S/C14H11NO/c15-9-10-3-5-12-11(8-10)4-6-14-13(12)2-1-7-16-14/h3-6,8H,1-2,7H2 |
| InChIKey | PJRYOXCRVQDKJE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |