C12H9NO2 — CID 83699699
3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-ynenitrile (PubChem CID 83699699) has the molecular formula C12H9NO2 and a molecular weight of 199.21 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-ynenitrile.
| Compound Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-ynenitrile |
|---|---|
| PubChem CID | 83699699 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-ynenitrile |
| SMILES | N#CC#Cc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C12H9NO2/c13-6-1-3-10-4-5-11-12(9-10)15-8-2-7-14-11/h4-5,9H,2,7-8H2 |
| InChIKey | TVIUVLFWVPDYAB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|