C11H10FN3O3 — CID 155318778
1-[(3R)-3-(azidomethyl)-7-fluoro-2,3-dihydro-1,4-benzodioxin-5-yl]ethanone (PubChem CID 155318778) has the molecular formula C11H10FN3O3 and a molecular weight of 251.22 g/mol. Its IUPAC name is 1-[(3R)-3-(azidomethyl)-7-fluoro-2,3-dihydro-1,4-benzodioxin-5-yl]ethanone.
| Compound Name | 1-[(3R)-3-(azidomethyl)-7-fluoro-2,3-dihydro-1,4-benzodioxin-5-yl]ethanone |
|---|---|
| PubChem CID | 155318778 |
| Molecular Formula | C11H10FN3O3 |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 1-[(3R)-3-(azidomethyl)-7-fluoro-2,3-dihydro-1,4-benzodioxin-5-yl]ethanone |
| SMILES | CC(=O)c1cc(F)cc2c1O[C@H](CN=[N+]=[N-])CO2 |
| InChI | InChI=1S/C11H10FN3O3/c1-6(16)9-2-7(12)3-10-11(9)18-8(5-17-10)4-14-15-13/h2-3,8H,4-5H2,1H3/t8-/m1/s1 |
| InChIKey | JQCHNFPZEZVLQG-MRVPVSSYSA-N |
| XLogP | 2.48 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|