C18H14Cl2FN3O5S — CID 155680225
[4-(3,4-dichloro-2-fluoroanilino)-7,8-dihydro-[1,4]dioxino[2,3-g]quinazolin-7-yl]methyl methanesulfonate (PubChem CID 155680225) has the molecular formula C18H14Cl2FN3O5S and a molecular weight of 474.30 g/mol. Its IUPAC name is [4-(3,4-dichloro-2-fluoroanilino)-7,8-dihydro-[1,4]dioxino[2,3-g]quinazolin-7-yl]methyl methanesulfonate.
| Compound Name | [4-(3,4-dichloro-2-fluoroanilino)-7,8-dihydro-[1,4]dioxino[2,3-g]quinazolin-7-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 155680225 |
| Molecular Formula | C18H14Cl2FN3O5S |
| Molecular Weight | 474.30 g/mol |
| Exact Mass | 473.00 |
| IUPAC Name | [4-(3,4-dichloro-2-fluoroanilino)-7,8-dihydro-[1,4]dioxino[2,3-g]quinazolin-7-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC1COc2cc3ncnc(Nc4ccc(Cl)c(Cl)c4F)c3cc2O1 |
| InChI | InChI=1S/C18H14Cl2FN3O5S/c1-30(25,26)28-7-9-6-27-14-5-13-10(4-15(14)29-9)18(23-8-22-13)24-12-3-2-11(19)16(20)17(12)21/h2-5,8-9H,6-7H2,1H3,(H,22,23,24) |
| InChIKey | JWYHYJUJHOBPCX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|