C15H7Cl2F4N3O3S — CID 171852899
[4-(3,4-dichloro-2-fluoroanilino)quinazolin-7-yl] trifluoromethanesulfonate (PubChem CID 171852899) has the molecular formula C15H7Cl2F4N3O3S and a molecular weight of 456.20 g/mol. Its IUPAC name is [4-(3,4-dichloro-2-fluoroanilino)quinazolin-7-yl] trifluoromethanesulfonate.
| Compound Name | [4-(3,4-dichloro-2-fluoroanilino)quinazolin-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171852899 |
| Molecular Formula | C15H7Cl2F4N3O3S |
| Molecular Weight | 456.20 g/mol |
| Exact Mass | 454.95 |
| IUPAC Name | [4-(3,4-dichloro-2-fluoroanilino)quinazolin-7-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(Nc3ccc(Cl)c(Cl)c3F)ncnc2c1)C(F)(F)F |
| InChI | InChI=1S/C15H7Cl2F4N3O3S/c16-9-3-4-10(13(18)12(9)17)24-14-8-2-1-7(5-11(8)22-6-23-14)27-28(25,26)15(19,20)21/h1-6H,(H,22,23,24) |
| InChIKey | MUQCJLOVCXCNKX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.20 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|