C25H21ClFN3O3 — CID 142677280
N-(3-chloro-4-fluorophenyl)-7-(2-phenylmethoxyethyl)-7,8-dihydro-[1,4]dioxino[2,3-g]quinazolin-4-amine (PubChem CID 142677280) has the molecular formula C25H21ClFN3O3 and a molecular weight of 465.91 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-7-(2-phenylmethoxyethyl)-7,8-dihydro-[1,4]dioxino[2,3-g]quinazolin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-7-(2-phenylmethoxyethyl)-7,8-dihydro-[1,4]dioxino[2,3-g]quinazolin-4-amine |
|---|---|
| PubChem CID | 142677280 |
| Molecular Formula | C25H21ClFN3O3 |
| Molecular Weight | 465.91 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-7-(2-phenylmethoxyethyl)-7,8-dihydro-[1,4]dioxino[2,3-g]quinazolin-4-amine |
| SMILES | Fc1ccc(Nc2ncnc3cc4c(cc23)OC(CCOCc2ccccc2)CO4)cc1Cl |
| InChI | InChI=1S/C25H21ClFN3O3/c26-20-10-17(6-7-21(20)27)30-25-19-11-24-23(12-22(19)28-15-29-25)32-14-18(33-24)8-9-31-13-16-4-2-1-3-5-16/h1-7,10-12,15,18H,8-9,13-14H2,(H,28,29,30) |
| InChIKey | UUZVRCZZDMQZKH-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.91 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|