C27H29Cl2FN4O7S — CID 72546141
[3-[4-[4-(3,4-dichloro-2-fluoroanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]oxypiperidin-1-yl]-3-oxopropyl] methanesulfonate (PubChem CID 72546141) has the molecular formula C27H29Cl2FN4O7S and a molecular weight of 643.52 g/mol. Its IUPAC name is [3-[4-[4-(3,4-dichloro-2-fluoroanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]oxypiperidin-1-yl]-3-oxopropyl] methanesulfonate.
| Compound Name | [3-[4-[4-(3,4-dichloro-2-fluoroanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]oxypiperidin-1-yl]-3-oxopropyl] methanesulfonate |
|---|---|
| PubChem CID | 72546141 |
| Molecular Formula | C27H29Cl2FN4O7S |
| Molecular Weight | 643.52 g/mol |
| Exact Mass | 642.11 |
| IUPAC Name | [3-[4-[4-(3,4-dichloro-2-fluoroanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]oxypiperidin-1-yl]-3-oxopropyl] methanesulfonate |
| SMILES | CS(=O)(=O)OCCC(=O)N1CCC(Oc2cc3c(Nc4ccc(Cl)c(Cl)c4F)ncnc3cc2OC2CCOC2)CC1 |
| InChI | InChI=1S/C27H29Cl2FN4O7S/c1-42(36,37)39-11-7-24(35)34-8-4-16(5-9-34)40-22-12-18-21(13-23(22)41-17-6-10-38-14-17)31-15-32-27(18)33-20-3-2-19(28)25(29)26(20)30/h2-3,12-13,15-17H,4-11,14H2,1H3,(H,31,32,33) |
| InChIKey | QXHSNEGMQZNXTD-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 129.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|