C22H22BFN4O2 — CID 170622569
CID 170622569 (PubChem CID 170622569) has the molecular formula C22H22BFN4O2 and a molecular weight of 404.25 g/mol.
| Compound Name | CID 170622569 |
|---|---|
| PubChem CID | 170622569 |
| Molecular Formula | C22H22BFN4O2 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(Nc2ncnc3cc4c(cc23)OC(CCN2CCCC2)CO4)c1F |
| InChI | InChI=1S/C22H22BFN4O2/c23-16-4-3-5-17(21(16)24)27-22-15-10-20-19(11-18(15)25-13-26-22)29-12-14(30-20)6-9-28-7-1-2-8-28/h3-5,10-11,13-14H,1-2,6-9,12H2,(H,25,26,27) |
| InChIKey | LCFUXAKHEBUTIA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|