C10H8O — CID 114746798
7-ethynyl-2,3-dihydro-1-benzofuran (PubChem CID 114746798) has the molecular formula C10H8O and a molecular weight of 144.17 g/mol. Its IUPAC name is 7-ethynyl-2,3-dihydro-1-benzofuran.
| Compound Name | 7-ethynyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 114746798 |
| Molecular Formula | C10H8O |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | 7-ethynyl-2,3-dihydro-1-benzofuran |
| SMILES | C#Cc1cccc2c1OCC2 |
| InChI | InChI=1S/C10H8O/c1-2-8-4-3-5-9-6-7-11-10(8)9/h1,3-5H,6-7H2 |
| InChIKey | CQVQJEYDMZWKRL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|