C11H8O3 — CID 114746810
3-(2,3-dihydro-1-benzofuran-7-yl)prop-2-ynoic acid (PubChem CID 114746810) has the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzofuran-7-yl)prop-2-ynoic acid.
| Compound Name | 3-(2,3-dihydro-1-benzofuran-7-yl)prop-2-ynoic acid |
|---|---|
| PubChem CID | 114746810 |
| Molecular Formula | C11H8O3 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 3-(2,3-dihydro-1-benzofuran-7-yl)prop-2-ynoic acid |
| SMILES | O=C(O)C#Cc1cccc2c1OCC2 |
| InChI | InChI=1S/C11H8O3/c12-10(13)5-4-8-2-1-3-9-6-7-14-11(8)9/h1-3H,6-7H2,(H,12,13) |
| InChIKey | VTSIOWZRCNVEEG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|