C17H29ClOPPd+ — CID 140728178
carbanide;chloropalladium(1+);ditert-butyl(2,3-dihydro-1-benzofuran-7-yl)phosphanium (PubChem CID 140728178) has the molecular formula C17H29ClOPPd+ and a molecular weight of 422.27 g/mol. Its IUPAC name is carbanide;chloropalladium(1+);ditert-butyl(2,3-dihydro-1-benzofuran-7-yl)phosphanium.
| Compound Name | carbanide;chloropalladium(1+);ditert-butyl(2,3-dihydro-1-benzofuran-7-yl)phosphanium |
|---|---|
| PubChem CID | 140728178 |
| Molecular Formula | C17H29ClOPPd+ |
| Molecular Weight | 422.27 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | carbanide;chloropalladium(1+);ditert-butyl(2,3-dihydro-1-benzofuran-7-yl)phosphanium |
| SMILES | CC(C)(C)[PH+](c1cccc2c1OCC2)C(C)(C)C.Cl[Pd+].[CH3-] |
| InChI | InChI=1S/C16H25OP.CH3.ClH.Pd/c1-15(2,3)18(16(4,5)6)13-9-7-8-12-10-11-17-14(12)13;;;/h7-9H,10-11H2,1-6H3;1H3;1H;/q;-1;;+2 |
| InChIKey | JETJNXXRRYHJQX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.27 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|