C14H25NO — CID 158727662
2,4-dihydro-1H-isoquinolin-3-one;ethane;methane (PubChem CID 158727662) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 2,4-dihydro-1H-isoquinolin-3-one;ethane;methane.
| Compound Name | 2,4-dihydro-1H-isoquinolin-3-one;ethane;methane |
|---|---|
| PubChem CID | 158727662 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 2,4-dihydro-1H-isoquinolin-3-one;ethane;methane |
| SMILES | C.CC.CC.O=C1Cc2ccccc2CN1 |
| InChI | InChI=1S/C9H9NO.2C2H6.CH4/c11-9-5-7-3-1-2-4-8(7)6-10-9;2*1-2;/h1-4H,5-6H2,(H,10,11);2*1-2H3;1H4 |
| InChIKey | IKSCTGXXLVCAPK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |