C8H8N2O3S — CID 115095914
8-amino-1,1-dioxo-3,4-dihydro-1λ6,4-benzothiazin-2-one (PubChem CID 115095914) has the molecular formula C8H8N2O3S and a molecular weight of 212.23 g/mol. Its IUPAC name is 8-amino-1,1-dioxo-3,4-dihydro-1λ6,4-benzothiazin-2-one.
| Compound Name | 8-amino-1,1-dioxo-3,4-dihydro-1λ6,4-benzothiazin-2-one |
|---|---|
| PubChem CID | 115095914 |
| Molecular Formula | C8H8N2O3S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 8-amino-1,1-dioxo-3,4-dihydro-1λ6,4-benzothiazin-2-one |
| SMILES | Nc1cccc2c1S(=O)(=O)C(=O)CN2 |
| InChI | InChI=1S/C8H8N2O3S/c9-5-2-1-3-6-8(5)14(12,13)7(11)4-10-6/h1-3,10H,4,9H2 |
| InChIKey | OEOWSCRJDBTHAD-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|