About 9-fluoro-2,3,4,5-tetrahydro-1λ6,5-benzothiazepine 1,1-dioxide
9-fluoro-2,3,4,5-tetrahydro-1λ6,5-benzothiazepine 1,1-dioxide (PubChem CID 83821517) has the molecular formula C9H10FNO2S
and a molecular weight of 215.25 g/mol. Its IUPAC name is 9-fluoro-2,3,4,5-tetrahydro-1λ6,5-benzothiazepine 1,1-dioxide.
Analyze 9-fluoro-2,3,4,5-tetrahydro-1λ6,5-benzothiazepine 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-fluoro-2,3,4,5-tetrahydro-1λ6,5-benzothiazepine 1,1-dioxide?
The IUPAC name of 9-fluoro-2,3,4,5-tetrahydro-1λ6,5-benzothiazepine 1,1-dioxide (CID 83821517) is 9-fluoro-2,3,4,5-tetrahydro-1λ6,5-benzothiazepine 1,1-dioxide.
What is the SMILES notation for 9-fluoro-2,3,4,5-tetrahydro-1λ6,5-benzothiazepine 1,1-dioxide?
The canonical SMILES for 9-fluoro-2,3,4,5-tetrahydro-1λ6,5-benzothiazepine 1,1-dioxide is O=S1(=O)CCCNc2cccc(F)c21.
What is the InChIKey of 9-fluoro-2,3,4,5-tetrahydro-1λ6,5-benzothiazepine 1,1-dioxide?
The InChIKey is ACFSZGCPSZKFPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNO2S/c10-7-3-1-4-8-9(7)14(12,13)6-2-5-11-8/h1,3-4,11H,2,5-6H2.
What are the key properties of 9-fluoro-2,3,4,5-tetrahydro-1λ6,5-benzothiazepine 1,1-dioxide?
9-fluoro-2,3,4,5-tetrahydro-1λ6,5-benzothiazepine 1,1-dioxide has a molecular weight of 215.25 g/mol, XLogP of 1.41, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-fluoro-2,3,4,5-tetrahydro-1λ6,5-benzothiazepine 1,1-dioxide is sourced from PubChem (CID 83821517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).