C9H9NO3S — CID 115094758
5-methyl-1,1-dioxo-3,4-dihydro-1λ6,4-benzothiazin-2-one (PubChem CID 115094758) has the molecular formula C9H9NO3S and a molecular weight of 211.24 g/mol. Its IUPAC name is 5-methyl-1,1-dioxo-3,4-dihydro-1λ6,4-benzothiazin-2-one.
| Compound Name | 5-methyl-1,1-dioxo-3,4-dihydro-1λ6,4-benzothiazin-2-one |
|---|---|
| PubChem CID | 115094758 |
| Molecular Formula | C9H9NO3S |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | 5-methyl-1,1-dioxo-3,4-dihydro-1λ6,4-benzothiazin-2-one |
| SMILES | Cc1cccc2c1NCC(=O)S2(=O)=O |
| InChI | InChI=1S/C9H9NO3S/c1-6-3-2-4-7-9(6)10-5-8(11)14(7,12)13/h2-4,10H,5H2,1H3 |
| InChIKey | YUKZTBYJTTUBLD-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|