C8H7NO4S — CID 115095516
5-hydroxy-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one (PubChem CID 115095516) has the molecular formula C8H7NO4S and a molecular weight of 213.21 g/mol. Its IUPAC name is 5-hydroxy-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one.
| Compound Name | 5-hydroxy-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 115095516 |
| Molecular Formula | C8H7NO4S |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.01 |
| IUPAC Name | 5-hydroxy-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one |
| SMILES | O=C1CS(=O)(=O)c2cccc(O)c2N1 |
| InChI | InChI=1S/C8H7NO4S/c10-5-2-1-3-6-8(5)9-7(11)4-14(6,12)13/h1-3,10H,4H2,(H,9,11) |
| InChIKey | XVFWEVMPEKCDFD-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|