C8H5BrFNO3S — CID 105356994
7-bromo-6-fluoro-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one (PubChem CID 105356994) has the molecular formula C8H5BrFNO3S and a molecular weight of 294.10 g/mol. Its IUPAC name is 7-bromo-6-fluoro-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one.
| Compound Name | 7-bromo-6-fluoro-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 105356994 |
| Molecular Formula | C8H5BrFNO3S |
| Molecular Weight | 294.10 g/mol |
| Exact Mass | 292.92 |
| IUPAC Name | 7-bromo-6-fluoro-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one |
| SMILES | O=C1CS(=O)(=O)c2cc(Br)c(F)cc2N1 |
| InChI | InChI=1S/C8H5BrFNO3S/c9-4-1-7-6(2-5(4)10)11-8(12)3-15(7,13)14/h1-2H,3H2,(H,11,12) |
| InChIKey | VYGNBTHABIIUIZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.10 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |