C15H13NO — CID 102431030
8-methyl-5,11-dihydrobenzo[c][1]benzazepin-6-one (PubChem CID 102431030) has the molecular formula C15H13NO and a molecular weight of 223.28 g/mol. Its IUPAC name is 8-methyl-5,11-dihydrobenzo[c][1]benzazepin-6-one.
| Compound Name | 8-methyl-5,11-dihydrobenzo[c][1]benzazepin-6-one |
|---|---|
| PubChem CID | 102431030 |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 8-methyl-5,11-dihydrobenzo[c][1]benzazepin-6-one |
| SMILES | Cc1ccc2c(c1)C(=O)Nc1ccccc1C2 |
| InChI | InChI=1S/C15H13NO/c1-10-6-7-11-9-12-4-2-3-5-14(12)16-15(17)13(11)8-10/h2-8H,9H2,1H3,(H,16,17) |
| InChIKey | STRSQZRCQNMHCN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |